C39H70O16 — CID 71474193
[(2R,3S,4S,5R,6R)-2-[(4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate (PubChem CID 71474193) has the molecular formula C39H70O16 and a molecular weight of 794.97 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-2-[(4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-2-[(4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 71474193 |
| Molecular Formula | C39H70O16 |
| Molecular Weight | 794.97 g/mol |
| Exact Mass | 794.47 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-2-[(4S,5S,6S)-2,3,4,5,6,7-hexahydroxyheptoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@H](OCC(O)C(O)[C@@H](O)[C@@H](O)[C@@H](O)CO)O[C@H](COC(=O)CCCCC)[C@@H](OC(=O)CCCCC)[C@@H]1OC(=O)CCCCC |
| InChI | InChI=1S/C39H70O16/c1-5-9-13-14-18-22-32(46)55-38-37(54-31(45)21-17-12-8-4)36(53-30(44)20-16-11-7-3)28(25-50-29(43)19-15-10-6-2)52-39(38)51-24-27(42)34(48)35(49)33(47)26(41)23-40/h26-28,33-42,47-49H,5-25H2,1-4H3/t26-,27?,28+,33-,34?,35-,36+,37-,38-,39+/m0/s1 |
| InChIKey | FPYPIVJEMZPTPD-VDRJPMRSSA-N |
| XLogP | 2.90 |
| TPSA | 245.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.97 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|