C41H74O15 — CID 162645309
[(2R,3S,4S,5R,6R)-4,5-di(heptanoyloxy)-6-(heptanoyloxymethyl)-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]oxan-3-yl] octanoate (PubChem CID 162645309) has the molecular formula C41H74O15 and a molecular weight of 807.03 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4,5-di(heptanoyloxy)-6-(heptanoyloxymethyl)-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]oxan-3-yl] octanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-4,5-di(heptanoyloxy)-6-(heptanoyloxymethyl)-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 162645309 |
| Molecular Formula | C41H74O15 |
| Molecular Weight | 807.03 g/mol |
| Exact Mass | 806.50 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4,5-di(heptanoyloxy)-6-(heptanoyloxymethyl)-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@H](OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)O[C@H](COC(=O)CCCCCC)[C@@H](OC(=O)CCCCCC)[C@@H]1OC(=O)CCCCCC |
| InChI | InChI=1S/C41H74O15/c1-5-9-13-17-21-25-35(48)56-40-39(55-34(47)24-20-16-12-8-4)38(54-33(46)23-19-15-11-7-3)31(28-51-32(45)22-18-14-10-6-2)53-41(40)52-27-30(44)37(50)36(49)29(43)26-42/h29-31,36-44,49-50H,5-28H2,1-4H3/t29-,30-,31-,36-,37-,38-,39+,40+,41-/m1/s1 |
| InChIKey | RSEBXHOAWMCWIC-IYSMSHCTSA-N |
| XLogP | 4.71 |
| TPSA | 224.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.03 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|