C36H64O14 — CID 90110480
[(2S,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-[(2S,3R)-1,2,3,4-tetrahydroxybutoxy]oxan-3-yl] octanoate (PubChem CID 90110480) has the molecular formula C36H64O14 and a molecular weight of 720.89 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-[(2S,3R)-1,2,3,4-tetrahydroxybutoxy]oxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-[(2S,3R)-1,2,3,4-tetrahydroxybutoxy]oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 90110480 |
| Molecular Formula | C36H64O14 |
| Molecular Weight | 720.89 g/mol |
| Exact Mass | 720.43 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-[(2S,3R)-1,2,3,4-tetrahydroxybutoxy]oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@H](OC(O)[C@@H](O)[C@H](O)CO)O[C@H](COC(=O)CCCCC)[C@@H](OC(=O)CCCCC)[C@@H]1OC(=O)CCCCC |
| InChI | InChI=1S/C36H64O14/c1-5-9-13-14-18-22-30(42)49-34-33(48-29(41)21-17-12-8-4)32(47-28(40)20-16-11-7-3)26(24-45-27(39)19-15-10-6-2)46-36(34)50-35(44)31(43)25(38)23-37/h25-26,31-38,43-44H,5-24H2,1-4H3/t25-,26-,31+,32-,33+,34+,35?,36+/m1/s1 |
| InChIKey | AIKOZOZBBXBKRM-OLSYAPAISA-N |
| XLogP | 4.14 |
| TPSA | 204.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.89 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|