C21H34O9 — CID 130188370
[(2R,3R,4R)-3,4,5-tri(butanoyloxy)oxolan-2-yl]methyl butanoate (PubChem CID 130188370) has the molecular formula C21H34O9 and a molecular weight of 430.49 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4,5-tri(butanoyloxy)oxolan-2-yl]methyl butanoate.
| Compound Name | [(2R,3R,4R)-3,4,5-tri(butanoyloxy)oxolan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 130188370 |
| Molecular Formula | C21H34O9 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | [(2R,3R,4R)-3,4,5-tri(butanoyloxy)oxolan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1OC(OC(=O)CCC)[C@H](OC(=O)CCC)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C21H34O9/c1-5-9-15(22)26-13-14-19(28-16(23)10-6-2)20(29-17(24)11-7-3)21(27-14)30-18(25)12-8-4/h14,19-21H,5-13H2,1-4H3/t14-,19-,20-,21?/m1/s1 |
| InChIKey | VGYKKJPXMCPRGO-XCKWHVFBSA-N |
| XLogP | 2.82 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|