C20H38O7 — CID 54076031
[(3R,4S,5S,6R)-2-butoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] decanoate (PubChem CID 54076031) has the molecular formula C20H38O7 and a molecular weight of 390.52 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-2-butoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] decanoate.
| Compound Name | [(3R,4S,5S,6R)-2-butoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] decanoate |
|---|---|
| PubChem CID | 54076031 |
| Molecular Formula | C20H38O7 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [(3R,4S,5S,6R)-2-butoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@H]1C(OCCCC)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H38O7/c1-3-5-7-8-9-10-11-12-16(22)27-19-18(24)17(23)15(14-21)26-20(19)25-13-6-4-2/h15,17-21,23-24H,3-14H2,1-2H3/t15-,17-,18+,19-,20?/m1/s1 |
| InChIKey | MJSQKJHYEFTCTF-FIBJEGPVSA-N |
| XLogP | 2.29 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|