C23H33NO12 — CID 166766719
4-O-[(2R,3R,4R,5S,6R)-4,5-di(butanoyloxy)-6-(butanoyloxymethyl)-3-nitrosooxan-2-yl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 166766719) has the molecular formula C23H33NO12 and a molecular weight of 515.51 g/mol. Its IUPAC name is 4-O-[(2R,3R,4R,5S,6R)-4,5-di(butanoyloxy)-6-(butanoyloxymethyl)-3-nitrosooxan-2-yl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(2R,3R,4R,5S,6R)-4,5-di(butanoyloxy)-6-(butanoyloxymethyl)-3-nitrosooxan-2-yl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 166766719 |
| Molecular Formula | C23H33NO12 |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 4-O-[(2R,3R,4R,5S,6R)-4,5-di(butanoyloxy)-6-(butanoyloxymethyl)-3-nitrosooxan-2-yl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | CCCC(=O)OC[C@H]1O[C@H](OC(=O)/C=C/C(=O)OC)[C@H](N=O)[C@@H](OC(=O)CCC)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C23H33NO12/c1-5-8-16(26)32-13-14-21(34-17(27)9-6-2)22(35-18(28)10-7-3)20(24-30)23(33-14)36-19(29)12-11-15(25)31-4/h11-12,14,20-23H,5-10,13H2,1-4H3/b12-11+/t14-,20-,21-,22-,23-/m1/s1 |
| InChIKey | SMZJHLREAQOFSV-CAYXRQMJSA-N |
| XLogP | 1.89 |
| TPSA | 170.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|