C23H32O13 — CID 151888132
1-O-methyl 4-O-[(2S,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-but-2-enedioate (PubChem CID 151888132) has the molecular formula C23H32O13 and a molecular weight of 516.50 g/mol. Its IUPAC name is 1-O-methyl 4-O-[(2S,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-but-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[(2S,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 151888132 |
| Molecular Formula | C23H32O13 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 1-O-methyl 4-O-[(2S,3R,4S,5R,6R)-3,4,5-tri(propanoyloxy)-6-(propanoyloxymethyl)oxan-2-yl] (E)-but-2-enedioate |
| SMILES | CCC(=O)OC[C@H]1O[C@@H](OC(=O)/C=C/C(=O)OC)[C@H](OC(=O)CC)[C@@H](OC(=O)CC)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C23H32O13/c1-6-14(24)31-12-13-20(33-15(25)7-2)21(34-16(26)8-3)22(35-17(27)9-4)23(32-13)36-19(29)11-10-18(28)30-5/h10-11,13,20-23H,6-9,12H2,1-5H3/b11-10+/t13-,20-,21+,22-,23+/m1/s1 |
| InChIKey | SQDRSVAIBXSLKG-UFTOWEAHSA-N |
| XLogP | 0.90 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|