C19H26O11 — CID 146659291
1-O-methyl 4-O-[(2R,3R,4R,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl] (E)-but-2-enedioate (PubChem CID 146659291) has the molecular formula C19H26O11 and a molecular weight of 430.41 g/mol. Its IUPAC name is 1-O-methyl 4-O-[(2R,3R,4R,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl] (E)-but-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[(2R,3R,4R,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 146659291 |
| Molecular Formula | C19H26O11 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-O-methyl 4-O-[(2R,3R,4R,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl] (E)-but-2-enedioate |
| SMILES | CCC(=O)O[C@H]1[C@@H](OC(=O)/C=C/C(=O)OC)OC[C@@H](OC(=O)CC)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C19H26O11/c1-5-12(20)27-11-10-26-19(30-16(24)9-8-15(23)25-4)18(29-14(22)7-3)17(11)28-13(21)6-2/h8-9,11,17-19H,5-7,10H2,1-4H3/b9-8+/t11-,17-,18-,19-/m1/s1 |
| InChIKey | HLSHBGJLZZJAMU-MXVLMGDCSA-N |
| XLogP | 0.58 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|