C14H22O8 — CID 137357258
[(3R,4S,5R,6R)-6-hydroxy-4,5-di(propanoyloxy)oxan-3-yl] propanoate (PubChem CID 137357258) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-hydroxy-4,5-di(propanoyloxy)oxan-3-yl] propanoate.
| Compound Name | [(3R,4S,5R,6R)-6-hydroxy-4,5-di(propanoyloxy)oxan-3-yl] propanoate |
|---|---|
| PubChem CID | 137357258 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [(3R,4S,5R,6R)-6-hydroxy-4,5-di(propanoyloxy)oxan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1[C@@H](OC(=O)CC)[C@H](OC(=O)CC)CO[C@H]1O |
| InChI | InChI=1S/C14H22O8/c1-4-9(15)20-8-7-19-14(18)13(22-11(17)6-3)12(8)21-10(16)5-2/h8,12-14,18H,4-7H2,1-3H3/t8-,12+,13-,14-/m1/s1 |
| InChIKey | KRGYXGSAMKTMHD-DSMZTOPNSA-N |
| XLogP | 0.30 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|