C14H22O8 — CID 156572981
3-[(3R,4R,5R)-2-hydroxy-4,5-di(propanoyloxy)oxan-3-yl]propanoic acid (PubChem CID 156572981) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is 3-[(3R,4R,5R)-2-hydroxy-4,5-di(propanoyloxy)oxan-3-yl]propanoic acid.
| Compound Name | 3-[(3R,4R,5R)-2-hydroxy-4,5-di(propanoyloxy)oxan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 156572981 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 3-[(3R,4R,5R)-2-hydroxy-4,5-di(propanoyloxy)oxan-3-yl]propanoic acid |
| SMILES | CCC(=O)O[C@H]1[C@H](OC(=O)CC)COC(O)[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C14H22O8/c1-3-11(17)21-9-7-20-14(19)8(5-6-10(15)16)13(9)22-12(18)4-2/h8-9,13-14,19H,3-7H2,1-2H3,(H,15,16)/t8-,9-,13-,14?/m1/s1 |
| InChIKey | KXJAHKJZRSQYJN-DVCIAYSJSA-N |
| XLogP | 0.46 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |