C11H16O8 — CID 143507655
4-[4,6-dihydroxy-5-(2-oxoethyl)oxan-3-yl]oxy-4-oxobutanoic acid (PubChem CID 143507655) has the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. Its IUPAC name is 4-[4,6-dihydroxy-5-(2-oxoethyl)oxan-3-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[4,6-dihydroxy-5-(2-oxoethyl)oxan-3-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 143507655 |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-[4,6-dihydroxy-5-(2-oxoethyl)oxan-3-yl]oxy-4-oxobutanoic acid |
| SMILES | O=CCC1C(O)OCC(OC(=O)CCC(=O)O)C1O |
| InChI | InChI=1S/C11H16O8/c12-4-3-6-10(16)7(5-18-11(6)17)19-9(15)2-1-8(13)14/h4,6-7,10-11,16-17H,1-3,5H2,(H,13,14) |
| InChIKey | BBPWJTDJYKVPRT-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|