C10H14O7 — CID 122693374
4-[[(3S,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobutanoic acid (PubChem CID 122693374) has the molecular formula C10H14O7 and a molecular weight of 246.21 g/mol. Its IUPAC name is 4-[[(3S,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(3S,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 122693374 |
| Molecular Formula | C10H14O7 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 4-[[(3S,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C10H14O7/c11-5-3-15-10-6(4-16-9(5)10)17-8(14)2-1-7(12)13/h5-6,9-11H,1-4H2,(H,12,13)/t5-,6-,9+,10+/m0/s1 |
| InChIKey | VXXGTZUBKDAAHG-DWAQLAQLSA-N |
| XLogP | -1.08 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |