C21H26O12 — CID 162180754
1-O-[(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-O-[(3R,3aR,6S,6aR)-6-(4-oxopent-2-enoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanedioate (PubChem CID 162180754) has the molecular formula C21H26O12 and a molecular weight of 470.43 g/mol. Its IUPAC name is 1-O-[(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-O-[(3R,3aR,6S,6aR)-6-(4-oxopent-2-enoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanedioate.
| Compound Name | 1-O-[(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-O-[(3R,3aR,6S,6aR)-6-(4-oxopent-2-enoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanedioate |
|---|---|
| PubChem CID | 162180754 |
| Molecular Formula | C21H26O12 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1-O-[(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-O-[(3R,3aR,6S,6aR)-6-(4-oxopent-2-enoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanedioate |
| SMILES | CC(=O)C=CC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)CCC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
| InChI | InChI=1S/C21H26O12/c1-10(22)2-3-15(24)32-13-8-29-21-14(9-30-20(13)21)33-17(26)5-4-16(25)31-12-7-28-18-11(23)6-27-19(12)18/h2-3,11-14,18-21,23H,4-9H2,1H3/t11-,12+,13+,14-,18-,19-,20-,21-/m1/s1 |
| InChIKey | BULCDKASRVNKKH-OGCVYIQYSA-N |
| XLogP | -1.40 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|