C17H22O9 — CID 122693388
4-O-[(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 1-O-[(3R,3aR,6S,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-but-2-enedioate (PubChem CID 122693388) has the molecular formula C17H22O9 and a molecular weight of 370.35 g/mol. Its IUPAC name is 4-O-[(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 1-O-[(3R,3aR,6S,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-but-2-enedioate.
| Compound Name | 4-O-[(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 1-O-[(3R,3aR,6S,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 122693388 |
| Molecular Formula | C17H22O9 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-O-[(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 1-O-[(3R,3aR,6S,6aS)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-but-2-enedioate |
| SMILES | C[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC(=O)/C=C\C(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C17H22O9/c1-8-4-21-16-10(6-23-14(8)16)25-12(19)2-3-13(20)26-11-7-24-15-9(18)5-22-17(11)15/h2-3,8-11,14-18H,4-7H2,1H3/b3-2-/t8-,9+,10+,11-,14-,15-,16-,17-/m1/s1 |
| InChIKey | XQRKPJJTSOVFEV-WXPQHJTESA-N |
| XLogP | -1.04 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|