C15H16O9 — CID 118404305
(E)-4-[[(3S,3aR,6S,6aR)-3-[(E)-4-oxopent-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobut-2-enoic acid (PubChem CID 118404305) has the molecular formula C15H16O9 and a molecular weight of 340.28 g/mol. Its IUPAC name is (E)-4-[[(3S,3aR,6S,6aR)-3-[(E)-4-oxopent-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[(3S,3aR,6S,6aR)-3-[(E)-4-oxopent-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 118404305 |
| Molecular Formula | C15H16O9 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (E)-4-[[(3S,3aR,6S,6aR)-3-[(E)-4-oxopent-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-oxobut-2-enoic acid |
| SMILES | CC(=O)/C=C/C(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H16O9/c1-8(16)2-4-12(19)23-9-6-21-15-10(7-22-14(9)15)24-13(20)5-3-11(17)18/h2-5,9-10,14-15H,6-7H2,1H3,(H,17,18)/b4-2+,5-3+/t9-,10-,14+,15+/m0/s1 |
| InChIKey | TYNSCYKLJBEPTP-WFXJFZKZSA-N |
| XLogP | -0.61 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|