C11H14O5 — CID 144610374
[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-4-oxopent-2-enoate (PubChem CID 144610374) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-4-oxopent-2-enoate.
| Compound Name | [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 144610374 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-4-oxopent-2-enoate |
| SMILES | CC(=O)/C=C\C(=O)O[C@@H]1CO[C@@H]2CCO[C@@H]21 |
| InChI | InChI=1S/C11H14O5/c1-7(12)2-3-10(13)16-9-6-15-8-4-5-14-11(8)9/h2-3,8-9,11H,4-6H2,1H3/b3-2-/t8-,9-,11+/m1/s1 |
| InChIKey | RGUPTXRBDNORRR-ZKGAVZJNSA-N |
| XLogP | 0.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|