C6H8O6 — CID 23030726
4-(dioxetan-3-yloxy)-4-oxobutanoic acid (PubChem CID 23030726) has the molecular formula C6H8O6 and a molecular weight of 176.12 g/mol. Its IUPAC name is 4-(dioxetan-3-yloxy)-4-oxobutanoic acid.
| Compound Name | 4-(dioxetan-3-yloxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 23030726 |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 4-(dioxetan-3-yloxy)-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OC1COO1 |
| InChI | InChI=1S/C6H8O6/c7-4(8)1-2-5(9)11-6-3-10-12-6/h6H,1-3H2,(H,7,8) |
| InChIKey | WBIVJRPNIJZKMU-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|