C12H14O9 — CID 91603165
4-[[5-(3-carboxypropanoyloxy)-2,5-dihydrofuran-2-yl]oxy]-4-oxobutanoic acid (PubChem CID 91603165) has the molecular formula C12H14O9 and a molecular weight of 302.24 g/mol. Its IUPAC name is 4-[[5-(3-carboxypropanoyloxy)-2,5-dihydrofuran-2-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[5-(3-carboxypropanoyloxy)-2,5-dihydrofuran-2-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91603165 |
| Molecular Formula | C12H14O9 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-[[5-(3-carboxypropanoyloxy)-2,5-dihydrofuran-2-yl]oxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OC1C=CC(OC(=O)CCC(=O)O)O1 |
| InChI | InChI=1S/C12H14O9/c13-7(14)1-3-9(17)19-11-5-6-12(21-11)20-10(18)4-2-8(15)16/h5-6,11-12H,1-4H2,(H,13,14)(H,15,16) |
| InChIKey | AGVKFUJSEHVSJD-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|