About disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride
disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride (PubChem CID 174571865) has the molecular formula C12H16Na2O10
and a molecular weight of 366.23 g/mol. Its IUPAC name is disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride.
Molecular Properties
| Compound Name | disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride |
| PubChem CID | 174571865 |
| Molecular Formula | C12H16Na2O10 |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride |
| SMILES | O=C(O)CCC(=O)OC(=O)CCC(=O)OC(=O)CCC(=O)O.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C12H14O10.2Na.2H/c13-7(14)1-3-9(17)21-11(19)5-6-12(20)22-10(18)4-2-8(15)16;;;;/h1-6H2,(H,13,14)(H,15,16);;;;/q;2*+1;2*-1 |
| InChIKey | BXUIVBGGTHERRF-UHFFFAOYSA-N |
| XLogP | -6.13 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | -6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride?
The IUPAC name of disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride (CID 174571865) is disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride.
What is the SMILES notation for disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride?
The canonical SMILES for disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride is O=C(O)CCC(=O)OC(=O)CCC(=O)OC(=O)CCC(=O)O.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride?
The InChIKey is BXUIVBGGTHERRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O10.2Na.2H/c13-7(14)1-3-9(17)21-11(19)5-6-12(20)22-10(18)4-2-8(15)16;;;;/h1-6H2,(H,13,14)(H,15,16);;;;/q;2*+1;2*-1.
What are the key properties of disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride?
disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride has a molecular weight of 366.23 g/mol, XLogP of -6.13, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;4-[4-(3-carboxypropanoyloxy)-4-oxobutanoyl]oxy-4-oxobutanoic acid;hydride is sourced from PubChem (CID 174571865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).