C42H62O24 — CID 135365156
bis(6-[6-(5-carboxypentanoyloxy)-6-oxohexanoyl]oxy-6-oxohexanoic acid);hexanedioic acid (PubChem CID 135365156) has the molecular formula C42H62O24 and a molecular weight of 950.93 g/mol. Its IUPAC name is bis(6-[6-(5-carboxypentanoyloxy)-6-oxohexanoyl]oxy-6-oxohexanoic acid);hexanedioic acid.
| Compound Name | bis(6-[6-(5-carboxypentanoyloxy)-6-oxohexanoyl]oxy-6-oxohexanoic acid);hexanedioic acid |
|---|---|
| PubChem CID | 135365156 |
| Molecular Formula | C42H62O24 |
| Molecular Weight | 950.93 g/mol |
| Exact Mass | 950.36 |
| IUPAC Name | bis(6-[6-(5-carboxypentanoyloxy)-6-oxohexanoyl]oxy-6-oxohexanoic acid);hexanedioic acid |
| SMILES | O=C(O)CCCCC(=O)O.O=C(O)CCCCC(=O)OC(=O)CCCCC(=O)OC(=O)CCCCC(=O)O.O=C(O)CCCCC(=O)OC(=O)CCCCC(=O)OC(=O)CCCCC(=O)O |
| InChI | InChI=1S/2C18H26O10.C6H10O4/c2*19-13(20)7-1-3-9-15(23)27-17(25)11-5-6-12-18(26)28-16(24)10-4-2-8-14(21)22;7-5(8)3-1-2-4-6(9)10/h2*1-12H2,(H,19,20)(H,21,22);1-4H2,(H,7,8)(H,9,10) |
| InChIKey | UBAZDMDCLAMQKN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 397.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|