C22H40O9 — CID 175232366
10-(9-carboxynonanoyloxy)-10-oxodecanoic acid;ethane-1,2-diol (PubChem CID 175232366) has the molecular formula C22H40O9 and a molecular weight of 448.55 g/mol. Its IUPAC name is 10-(9-carboxynonanoyloxy)-10-oxodecanoic acid;ethane-1,2-diol.
| Compound Name | 10-(9-carboxynonanoyloxy)-10-oxodecanoic acid;ethane-1,2-diol |
|---|---|
| PubChem CID | 175232366 |
| Molecular Formula | C22H40O9 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 10-(9-carboxynonanoyloxy)-10-oxodecanoic acid;ethane-1,2-diol |
| SMILES | O=C(O)CCCCCCCCC(=O)OC(=O)CCCCCCCCC(=O)O.OCCO |
| InChI | InChI=1S/C20H34O7.C2H6O2/c21-17(22)13-9-5-1-3-7-11-15-19(25)27-20(26)16-12-8-4-2-6-10-14-18(23)24;3-1-2-4/h1-16H2,(H,21,22)(H,23,24);3-4H,1-2H2 |
| InChIKey | CZAFKRWGAKACAO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|