C37H52O24 — CID 174936379
bis(4-[8-(3-carboxypropanoyloxy)-8-oxooctanoyl]oxy-4-oxobutanoic acid);pentanedioic acid (PubChem CID 174936379) has the molecular formula C37H52O24 and a molecular weight of 880.80 g/mol. Its IUPAC name is bis(4-[8-(3-carboxypropanoyloxy)-8-oxooctanoyl]oxy-4-oxobutanoic acid);pentanedioic acid.
| Compound Name | bis(4-[8-(3-carboxypropanoyloxy)-8-oxooctanoyl]oxy-4-oxobutanoic acid);pentanedioic acid |
|---|---|
| PubChem CID | 174936379 |
| Molecular Formula | C37H52O24 |
| Molecular Weight | 880.80 g/mol |
| Exact Mass | 880.28 |
| IUPAC Name | bis(4-[8-(3-carboxypropanoyloxy)-8-oxooctanoyl]oxy-4-oxobutanoic acid);pentanedioic acid |
| SMILES | O=C(O)CCC(=O)OC(=O)CCCCCCC(=O)OC(=O)CCC(=O)O.O=C(O)CCC(=O)OC(=O)CCCCCCC(=O)OC(=O)CCC(=O)O.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/2C16H22O10.C5H8O4/c2*17-11(18)7-9-15(23)25-13(21)5-3-1-2-4-6-14(22)26-16(24)10-8-12(19)20;6-4(7)2-1-3-5(8)9/h2*1-10H2,(H,17,18)(H,19,20);1-3H2,(H,6,7)(H,8,9) |
| InChIKey | GKRYWUMHWZJBFC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 397.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|