C17H28O11 — CID 146693321
[(3R,4S,5R,6R)-6-hydroxy-4,5-bis(3-hydroxybutanoyloxy)oxan-3-yl] 3-hydroxybutanoate (PubChem CID 146693321) has the molecular formula C17H28O11 and a molecular weight of 408.40 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-hydroxy-4,5-bis(3-hydroxybutanoyloxy)oxan-3-yl] 3-hydroxybutanoate.
| Compound Name | [(3R,4S,5R,6R)-6-hydroxy-4,5-bis(3-hydroxybutanoyloxy)oxan-3-yl] 3-hydroxybutanoate |
|---|---|
| PubChem CID | 146693321 |
| Molecular Formula | C17H28O11 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [(3R,4S,5R,6R)-6-hydroxy-4,5-bis(3-hydroxybutanoyloxy)oxan-3-yl] 3-hydroxybutanoate |
| SMILES | CC(O)CC(=O)O[C@@H]1[C@@H](OC(=O)CC(C)O)[C@H](OC(=O)CC(C)O)CO[C@H]1O |
| InChI | InChI=1S/C17H28O11/c1-8(18)4-12(21)26-11-7-25-17(24)16(28-14(23)6-10(3)20)15(11)27-13(22)5-9(2)19/h8-11,15-20,24H,4-7H2,1-3H3/t8?,9?,10?,11-,15+,16-,17-/m1/s1 |
| InChIKey | QKTSUDWAYYPERF-DRZNYBALSA-N |
| XLogP | -1.62 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|