C20H27ClO10 — CID 10552043
[(3R,4S,5R,6R)-6-chloro-4,5-bis(4-oxopentanoyloxy)oxan-3-yl] 4-oxopentanoate (PubChem CID 10552043) has the molecular formula C20H27ClO10 and a molecular weight of 462.88 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-chloro-4,5-bis(4-oxopentanoyloxy)oxan-3-yl] 4-oxopentanoate.
| Compound Name | [(3R,4S,5R,6R)-6-chloro-4,5-bis(4-oxopentanoyloxy)oxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 10552043 |
| Molecular Formula | C20H27ClO10 |
| Molecular Weight | 462.88 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [(3R,4S,5R,6R)-6-chloro-4,5-bis(4-oxopentanoyloxy)oxan-3-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)O[C@@H]1[C@@H](OC(=O)CCC(C)=O)[C@H](OC(=O)CCC(C)=O)CO[C@@H]1Cl |
| InChI | InChI=1S/C20H27ClO10/c1-11(22)4-7-15(25)29-14-10-28-20(21)19(31-17(27)9-6-13(3)24)18(14)30-16(26)8-5-12(2)23/h14,18-20H,4-10H2,1-3H3/t14-,18+,19-,20+/m1/s1 |
| InChIKey | BWPBIBMNDIOZSG-YGBSJELFSA-N |
| XLogP | 1.42 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.88 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|