C16H22N2O8 — CID 144610427
[(3R,3aR,6R,6aR)-6-(3-cyanatopropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-cyanatopropanoate;ethane (PubChem CID 144610427) has the molecular formula C16H22N2O8 and a molecular weight of 370.36 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-6-(3-cyanatopropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-cyanatopropanoate;ethane.
| Compound Name | [(3R,3aR,6R,6aR)-6-(3-cyanatopropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-cyanatopropanoate;ethane |
|---|---|
| PubChem CID | 144610427 |
| Molecular Formula | C16H22N2O8 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [(3R,3aR,6R,6aR)-6-(3-cyanatopropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-cyanatopropanoate;ethane |
| SMILES | CC.N#COCCC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)CCOC#N |
| InChI | InChI=1S/C14H16N2O8.C2H6/c15-7-19-3-1-11(17)23-9-5-21-14-10(6-22-13(9)14)24-12(18)2-4-20-8-16;1-2/h9-10,13-14H,1-6H2;1-2H3/t9-,10-,13-,14-;/m1./s1 |
| InChIKey | NPOUJBCJIKOTSG-FNPUCXIFSA-N |
| XLogP | 0.41 |
| TPSA | 137.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|