C14H18N2O8 — CID 144610414
[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 3-cyanatopropanoate;3-cyanatopropanoic acid (PubChem CID 144610414) has the molecular formula C14H18N2O8 and a molecular weight of 342.30 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 3-cyanatopropanoate;3-cyanatopropanoic acid.
| Compound Name | [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 3-cyanatopropanoate;3-cyanatopropanoic acid |
|---|---|
| PubChem CID | 144610414 |
| Molecular Formula | C14H18N2O8 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 3-cyanatopropanoate;3-cyanatopropanoic acid |
| SMILES | N#COCCC(=O)O.N#COCCC(=O)OC1CO[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C10H13NO5.C4H5NO3/c11-6-13-3-2-9(12)16-8-5-15-7-1-4-14-10(7)8;5-3-8-2-1-4(6)7/h7-8,10H,1-5H2;1-2H2,(H,6,7)/t7-,8?,10+;/m1./s1 |
| InChIKey | OIYOJMXAOXCGEW-VMKQZJJLSA-N |
| XLogP | -0.07 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|