C12H17Cl3O6 — CID 89240280
[(2R,5S)-2-[(2,2,2-trichloro-1-hydroxyethoxy)methyl]-5-tritiooxolan-3-yl] 4-oxopentanoate (PubChem CID 89240280) has the molecular formula C12H17Cl3O6 and a molecular weight of 365.63 g/mol. Its IUPAC name is [(2R,5S)-2-[(2,2,2-trichloro-1-hydroxyethoxy)methyl]-5-tritiooxolan-3-yl] 4-oxopentanoate.
| Compound Name | [(2R,5S)-2-[(2,2,2-trichloro-1-hydroxyethoxy)methyl]-5-tritiooxolan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 89240280 |
| Molecular Formula | C12H17Cl3O6 |
| Molecular Weight | 365.63 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | [(2R,5S)-2-[(2,2,2-trichloro-1-hydroxyethoxy)methyl]-5-tritiooxolan-3-yl] 4-oxopentanoate |
| SMILES | [3H][C@H]1CC(OC(=O)CCC(C)=O)[C@@H](COC(O)C(Cl)(Cl)Cl)O1 |
| InChI | InChI=1S/C12H17Cl3O6/c1-7(16)2-3-10(17)21-8-4-5-19-9(8)6-20-11(18)12(13,14)15/h8-9,11,18H,2-6H2,1H3/t8?,9-,11?/m1/s1/i5T/t5-,8?,9+,11?/m0 |
| InChIKey | ANJICIQQHFETQM-MFEWXHRASA-N |
| XLogP | 1.76 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.63 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|