C7H14O3P+ — CID 161244881
[(2R,5R)-2-ethyl-5-tritiooxolan-3-yl]oxy-methyl-oxophosphanium (PubChem CID 161244881) has the molecular formula C7H14O3P+ and a molecular weight of 179.17 g/mol. Its IUPAC name is [(2R,5R)-2-ethyl-5-tritiooxolan-3-yl]oxy-methyl-oxophosphanium.
| Compound Name | [(2R,5R)-2-ethyl-5-tritiooxolan-3-yl]oxy-methyl-oxophosphanium |
|---|---|
| PubChem CID | 161244881 |
| Molecular Formula | C7H14O3P+ |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | [(2R,5R)-2-ethyl-5-tritiooxolan-3-yl]oxy-methyl-oxophosphanium |
| SMILES | [3H][C@@H]1CC(O[P+](C)=O)[C@@H](CC)O1 |
| InChI | InChI=1S/C7H14O3P/c1-3-6-7(4-5-9-6)10-11(2)8/h6-7H,3-5H2,1-2H3/q+1/t6-,7?/m1/s1/i5T/t5-,6-,7? |
| InChIKey | YKRLHQZYFCHNPC-NTBCJBIKSA-N |
| XLogP | 1.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|