C10H17ClNO2P — CID 59976665
3-[chloro-[[(2R,3S)-2-ethyl-5-tritiooxolan-3-yl]methyl]phosphanyl]oxypropanenitrile (PubChem CID 59976665) has the molecular formula C10H17ClNO2P and a molecular weight of 251.69 g/mol. Its IUPAC name is 3-[chloro-[[(2R,3S)-2-ethyl-5-tritiooxolan-3-yl]methyl]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[chloro-[[(2R,3S)-2-ethyl-5-tritiooxolan-3-yl]methyl]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 59976665 |
| Molecular Formula | C10H17ClNO2P |
| Molecular Weight | 251.69 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-[chloro-[[(2R,3S)-2-ethyl-5-tritiooxolan-3-yl]methyl]phosphanyl]oxypropanenitrile |
| SMILES | [3H]C1C[C@H](CP(Cl)OCCC#N)[C@@H](CC)O1 |
| InChI | InChI=1S/C10H17ClNO2P/c1-2-10-9(4-7-13-10)8-15(11)14-6-3-5-12/h9-10H,2-4,6-8H2,1H3/t9-,10-,15?/m1/s1/i7T/t7?,9-,10-,15? |
| InChIKey | OWRRXXVZAIKURY-HZQVYVPRSA-N |
| XLogP | 3.28 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.69 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|