About 2-cyanoethyl dipropan-2-yl phosphite
2-cyanoethyl dipropan-2-yl phosphite (PubChem CID 22619650) has the molecular formula C9H18NO3P
and a molecular weight of 219.22 g/mol. Its IUPAC name is 2-cyanoethyl dipropan-2-yl phosphite.
Molecular Properties
| Compound Name | 2-cyanoethyl dipropan-2-yl phosphite |
| PubChem CID | 22619650 |
| Molecular Formula | C9H18NO3P |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-cyanoethyl dipropan-2-yl phosphite |
| SMILES | CC(C)OP(OCCC#N)OC(C)C |
| InChI | InChI=1S/C9H18NO3P/c1-8(2)12-14(13-9(3)4)11-7-5-6-10/h8-9H,5,7H2,1-4H3 |
| InChIKey | LVCLHUMNSHFOBL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl dipropan-2-yl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl dipropan-2-yl phosphite?
The IUPAC name of 2-cyanoethyl dipropan-2-yl phosphite (CID 22619650) is 2-cyanoethyl dipropan-2-yl phosphite.
What is the SMILES notation for 2-cyanoethyl dipropan-2-yl phosphite?
The canonical SMILES for 2-cyanoethyl dipropan-2-yl phosphite is CC(C)OP(OCCC#N)OC(C)C.
What is the InChIKey of 2-cyanoethyl dipropan-2-yl phosphite?
The InChIKey is LVCLHUMNSHFOBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO3P/c1-8(2)12-14(13-9(3)4)11-7-5-6-10/h8-9H,5,7H2,1-4H3.
What are the key properties of 2-cyanoethyl dipropan-2-yl phosphite?
2-cyanoethyl dipropan-2-yl phosphite has a molecular weight of 219.22 g/mol, XLogP of 2.99, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl dipropan-2-yl phosphite is sourced from PubChem (CID 22619650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).