C15H26ClN4O5P3 — CID 11844850
[[chloro(2-cyanoethoxy)phosphanyl]oxy-[di(propan-2-yl)amino]phosphanyl] bis(2-cyanoethyl) phosphite (PubChem CID 11844850) has the molecular formula C15H26ClN4O5P3 and a molecular weight of 470.77 g/mol. Its IUPAC name is [[chloro(2-cyanoethoxy)phosphanyl]oxy-[di(propan-2-yl)amino]phosphanyl] bis(2-cyanoethyl) phosphite.
| Compound Name | [[chloro(2-cyanoethoxy)phosphanyl]oxy-[di(propan-2-yl)amino]phosphanyl] bis(2-cyanoethyl) phosphite |
|---|---|
| PubChem CID | 11844850 |
| Molecular Formula | C15H26ClN4O5P3 |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | [[chloro(2-cyanoethoxy)phosphanyl]oxy-[di(propan-2-yl)amino]phosphanyl] bis(2-cyanoethyl) phosphite |
| SMILES | CC(C)N(C(C)C)P(OP(Cl)OCCC#N)OP(OCCC#N)OCCC#N |
| InChI | InChI=1S/C15H26ClN4O5P3/c1-14(2)20(15(3)4)27(24-26(16)21-11-5-8-17)25-28(22-12-6-9-18)23-13-7-10-19/h14-15H,5-7,11-13H2,1-4H3 |
| InChIKey | FEFAWVUITCHFHB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 120.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|