C11H27N4O2P — CID 170783738
3-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxypropanenitrile;methylhydrazine (PubChem CID 170783738) has the molecular formula C11H27N4O2P and a molecular weight of 278.34 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxypropanenitrile;methylhydrazine.
| Compound Name | 3-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxypropanenitrile;methylhydrazine |
|---|---|
| PubChem CID | 170783738 |
| Molecular Formula | C11H27N4O2P |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxypropanenitrile;methylhydrazine |
| SMILES | CNN.COP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C10H21N2O2P.CH6N2/c1-9(2)12(10(3)4)15(13-5)14-8-6-7-11;1-3-2/h9-10H,6,8H2,1-5H3;3H,2H2,1H3 |
| InChIKey | OTFCEXBPDOKWEX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|