C23H53N4OP — CID 170630587
3-bis[di(propan-2-yl)amino]phosphanyloxypropanenitrile;ethane;N-propan-2-ylpropan-2-amine (PubChem CID 170630587) has the molecular formula C23H53N4OP and a molecular weight of 432.68 g/mol. Its IUPAC name is 3-bis[di(propan-2-yl)amino]phosphanyloxypropanenitrile;ethane;N-propan-2-ylpropan-2-amine.
| Compound Name | 3-bis[di(propan-2-yl)amino]phosphanyloxypropanenitrile;ethane;N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 170630587 |
| Molecular Formula | C23H53N4OP |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.40 |
| IUPAC Name | 3-bis[di(propan-2-yl)amino]phosphanyloxypropanenitrile;ethane;N-propan-2-ylpropan-2-amine |
| SMILES | CC.CC(C)N(C(C)C)P(OCCC#N)N(C(C)C)C(C)C.CC(C)NC(C)C |
| InChI | InChI=1S/C15H32N3OP.C6H15N.C2H6/c1-12(2)17(13(3)4)20(19-11-9-10-16)18(14(5)6)15(7)8;1-5(2)7-6(3)4;1-2/h12-15H,9,11H2,1-8H3;5-7H,1-4H3;1-2H3 |
| InChIKey | MNMMNQYQJJJSJT-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 51.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|