C13H28N3O2P — CID 88576258
3-[2-(dimethylamino)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 88576258) has the molecular formula C13H28N3O2P and a molecular weight of 289.36 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[2-(dimethylamino)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 88576258 |
| Molecular Formula | C13H28N3O2P |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 3-[2-(dimethylamino)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCCN(C)C |
| InChI | InChI=1S/C13H28N3O2P/c1-12(2)16(13(3)4)19(17-10-7-8-14)18-11-9-15(5)6/h12-13H,7,9-11H2,1-6H3 |
| InChIKey | NBKNQIHTIZNWEF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|