C13H27N2O4PS — CID 76660393
3-[[di(propan-2-yl)amino]-(2-ethylsulfonylethoxy)phosphanyl]oxypropanenitrile (PubChem CID 76660393) has the molecular formula C13H27N2O4PS and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-(2-ethylsulfonylethoxy)phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-(2-ethylsulfonylethoxy)phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 76660393 |
| Molecular Formula | C13H27N2O4PS |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-(2-ethylsulfonylethoxy)phosphanyl]oxypropanenitrile |
| SMILES | CCS(=O)(=O)CCOP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C13H27N2O4PS/c1-6-21(16,17)11-10-19-20(18-9-7-8-14)15(12(2)3)13(4)5/h12-13H,6-7,9-11H2,1-5H3 |
| InChIKey | ISPYGRZWCPCFBR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|