C16H30N3O3P — CID 56960783
N-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]-2-methylprop-2-enamide (PubChem CID 56960783) has the molecular formula C16H30N3O3P and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]-2-methylprop-2-enamide.
| Compound Name | N-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 56960783 |
| Molecular Formula | C16H30N3O3P |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCOP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C16H30N3O3P/c1-13(2)16(20)18-10-8-12-22-23(21-11-7-9-17)19(14(3)4)15(5)6/h14-15H,1,7-8,10-12H2,2-6H3,(H,18,20) |
| InChIKey | RDFMSVZYWIERHV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|