C18H35BrN3O3P — CID 132523788
2-bromo-N-[5-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypentyl]-2-methylpropanamide (PubChem CID 132523788) has the molecular formula C18H35BrN3O3P and a molecular weight of 452.37 g/mol. Its IUPAC name is 2-bromo-N-[5-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypentyl]-2-methylpropanamide.
| Compound Name | 2-bromo-N-[5-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypentyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 132523788 |
| Molecular Formula | C18H35BrN3O3P |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-bromo-N-[5-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypentyl]-2-methylpropanamide |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCCCCCNC(=O)C(C)(C)Br |
| InChI | InChI=1S/C18H35BrN3O3P/c1-15(2)22(16(3)4)26(25-14-10-11-20)24-13-9-7-8-12-21-17(23)18(5,6)19/h15-16H,7-10,12-14H2,1-6H3,(H,21,23) |
| InChIKey | RYCFKKNPDKFMPY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|