C12H27N2O4P — CID 91475928
4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxybutylcarbamic acid (PubChem CID 91475928) has the molecular formula C12H27N2O4P and a molecular weight of 294.33 g/mol. Its IUPAC name is 4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxybutylcarbamic acid.
| Compound Name | 4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxybutylcarbamic acid |
|---|---|
| PubChem CID | 91475928 |
| Molecular Formula | C12H27N2O4P |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxybutylcarbamic acid |
| SMILES | COP(OCCCCNC(=O)O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C12H27N2O4P/c1-10(2)14(11(3)4)19(17-5)18-9-7-6-8-13-12(15)16/h10-11,13H,6-9H2,1-5H3,(H,15,16) |
| InChIKey | ZAMSLPLSIWEAHA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|