C15H31F3N3O3P — CID 89002790
N-[4-[1-aminopropan-2-yloxy-[di(propan-2-yl)amino]phosphanyl]oxybutyl]-2,2,2-trifluoroacetamide (PubChem CID 89002790) has the molecular formula C15H31F3N3O3P and a molecular weight of 389.40 g/mol. Its IUPAC name is N-[4-[1-aminopropan-2-yloxy-[di(propan-2-yl)amino]phosphanyl]oxybutyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[1-aminopropan-2-yloxy-[di(propan-2-yl)amino]phosphanyl]oxybutyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 89002790 |
| Molecular Formula | C15H31F3N3O3P |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[4-[1-aminopropan-2-yloxy-[di(propan-2-yl)amino]phosphanyl]oxybutyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(CN)OP(OCCCCNC(=O)C(F)(F)F)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H31F3N3O3P/c1-11(2)21(12(3)4)25(24-13(5)10-19)23-9-7-6-8-20-14(22)15(16,17)18/h11-13H,6-10,19H2,1-5H3,(H,20,22) |
| InChIKey | XRHPPLQEJDUOOE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|