C15H30F3N2O3P — CID 54183086
N-[6-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyhexyl]-2,2,2-trifluoroacetamide (PubChem CID 54183086) has the molecular formula C15H30F3N2O3P and a molecular weight of 374.38 g/mol. Its IUPAC name is N-[6-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyhexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[6-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyhexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 54183086 |
| Molecular Formula | C15H30F3N2O3P |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-[6-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyhexyl]-2,2,2-trifluoroacetamide |
| SMILES | COP(OCCCCCCNC(=O)C(F)(F)F)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H30F3N2O3P/c1-12(2)20(13(3)4)24(22-5)23-11-9-7-6-8-10-19-14(21)15(16,17)18/h12-13H,6-11H2,1-5H3,(H,19,21) |
| InChIKey | PDFRXNGPBINTFX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|