C14H30F3N2O2P — CID 158284909
N-[4-[[di(propan-2-yl)amino]-methylphosphanyl]oxybutyl]-2,2,2-trifluoroacetamide;methane (PubChem CID 158284909) has the molecular formula C14H30F3N2O2P and a molecular weight of 346.37 g/mol. Its IUPAC name is N-[4-[[di(propan-2-yl)amino]-methylphosphanyl]oxybutyl]-2,2,2-trifluoroacetamide;methane.
| Compound Name | N-[4-[[di(propan-2-yl)amino]-methylphosphanyl]oxybutyl]-2,2,2-trifluoroacetamide;methane |
|---|---|
| PubChem CID | 158284909 |
| Molecular Formula | C14H30F3N2O2P |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[4-[[di(propan-2-yl)amino]-methylphosphanyl]oxybutyl]-2,2,2-trifluoroacetamide;methane |
| SMILES | C.CC(C)N(C(C)C)P(C)OCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H26F3N2O2P.CH4/c1-10(2)18(11(3)4)21(5)20-9-7-6-8-17-12(19)13(14,15)16;/h10-11H,6-9H2,1-5H3,(H,17,19);1H4 |
| InChIKey | GKQTYHAEJFWNGM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|