C19H35F3N3O6P — CID 88925286
N-[2-[2-[2-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 88925286) has the molecular formula C19H35F3N3O6P and a molecular weight of 489.47 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[2-[2-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88925286 |
| Molecular Formula | C19H35F3N3O6P |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[2-[2-[2-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCCOCCOCCOCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H35F3N3O6P/c1-16(2)25(17(3)4)32(30-8-5-6-23)31-15-14-29-13-12-28-11-10-27-9-7-24-18(26)19(20,21)22/h16-17H,5,7-15H2,1-4H3,(H,24,26) |
| InChIKey | NFIAUYHOGRWWBX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|