C18H35F3N3O3P — CID 176716502
N-[6-[[di(propan-2-yl)amino]-(3-methyliminopropoxy)phosphanyl]oxyhexyl]-2,2,2-trifluoroacetamide (PubChem CID 176716502) has the molecular formula C18H35F3N3O3P and a molecular weight of 429.46 g/mol. Its IUPAC name is N-[6-[[di(propan-2-yl)amino]-(3-methyliminopropoxy)phosphanyl]oxyhexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[6-[[di(propan-2-yl)amino]-(3-methyliminopropoxy)phosphanyl]oxyhexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 176716502 |
| Molecular Formula | C18H35F3N3O3P |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[6-[[di(propan-2-yl)amino]-(3-methyliminopropoxy)phosphanyl]oxyhexyl]-2,2,2-trifluoroacetamide |
| SMILES | C/N=C/CCOP(OCCCCCCNC(=O)C(F)(F)F)N(C(C)C)C(C)C |
| InChI | InChI=1S/C18H35F3N3O3P/c1-15(2)24(16(3)4)28(27-14-10-11-22-5)26-13-9-7-6-8-12-23-17(25)18(19,20)21/h11,15-16H,6-10,12-14H2,1-5H3,(H,23,25)/b22-11+ |
| InChIKey | CBJRBJFKUMMAIW-SSDVNMTOSA-N |
| XLogP | 4.69 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|