C29H56N5O5P — CID 156733354
N-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexyl]-N'-[3-ethyl-6-(methylamino)-6-oxohexan-3-yl]pentanediamide (PubChem CID 156733354) has the molecular formula C29H56N5O5P and a molecular weight of 585.77 g/mol. Its IUPAC name is N-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexyl]-N'-[3-ethyl-6-(methylamino)-6-oxohexan-3-yl]pentanediamide.
| Compound Name | N-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexyl]-N'-[3-ethyl-6-(methylamino)-6-oxohexan-3-yl]pentanediamide |
|---|---|
| PubChem CID | 156733354 |
| Molecular Formula | C29H56N5O5P |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.40 |
| IUPAC Name | N-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexyl]-N'-[3-ethyl-6-(methylamino)-6-oxohexan-3-yl]pentanediamide |
| SMILES | CCC(CC)(CCC(=O)NC)NC(=O)CCCC(=O)NCCCCCCOP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C29H56N5O5P/c1-8-29(9-2,19-18-26(35)31-7)33-28(37)17-14-16-27(36)32-21-12-10-11-13-22-38-40(39-23-15-20-30)34(24(3)4)25(5)6/h24-25H,8-19,21-23H2,1-7H3,(H,31,35)(H,32,36)(H,33,37) |
| InChIKey | HHZWNHVNFDWKLI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|