C11H25N2O4P — CID 91605110
3-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxypropylcarbamic acid (PubChem CID 91605110) has the molecular formula C11H25N2O4P and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxypropylcarbamic acid.
| Compound Name | 3-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxypropylcarbamic acid |
|---|---|
| PubChem CID | 91605110 |
| Molecular Formula | C11H25N2O4P |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxypropylcarbamic acid |
| SMILES | COP(OCCCNC(=O)O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C11H25N2O4P/c1-9(2)13(10(3)4)18(16-5)17-8-6-7-12-11(14)15/h9-10,12H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | RJAOKZYIDRRGAC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|