C12H23N2O4P — CID 59593926
methyl 2-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxyacetate (PubChem CID 59593926) has the molecular formula C12H23N2O4P and a molecular weight of 290.30 g/mol. Its IUPAC name is methyl 2-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxyacetate.
| Compound Name | methyl 2-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxyacetate |
|---|---|
| PubChem CID | 59593926 |
| Molecular Formula | C12H23N2O4P |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | methyl 2-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxyacetate |
| SMILES | [C-]#[N+]CCOP(OCC(=O)OC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C12H23N2O4P/c1-10(2)14(11(3)4)19(17-8-7-13-5)18-9-12(15)16-6/h10-11H,7-9H2,1-4,6H3 |
| InChIKey | FBOLTWVPEATXMR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|