C16H31N2O4P — CID 161165198
N-[[(2R,3R,4S,5S)-2-(deuteriomethyl)-4-methoxy-5-methyloxolan-3-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 161165198) has the molecular formula C16H31N2O4P and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[[(2R,3R,4S,5S)-2-(deuteriomethyl)-4-methoxy-5-methyloxolan-3-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[[(2R,3R,4S,5S)-2-(deuteriomethyl)-4-methoxy-5-methyloxolan-3-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 161165198 |
| Molecular Formula | C16H31N2O4P |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N-[[(2R,3R,4S,5S)-2-(deuteriomethyl)-4-methoxy-5-methyloxolan-3-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | [2H]C[C@H]1O[C@@H](C)[C@H](OC)[C@@H]1OP(OCC[N+]#[C-])N(C(C)C)C(C)C |
| InChI | InChI=1S/C16H31N2O4P/c1-11(2)18(12(3)4)23(20-10-9-17-7)22-16-14(6)21-13(5)15(16)19-8/h11-16H,9-10H2,1-6,8H3/t13-,14+,15-,16+,23?/m0/s1/i6D |
| InChIKey | RQYPZTFYPUEGOZ-FNRXKBNQSA-N |
| XLogP | 3.48 |
| TPSA | 44.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|