C20H32FN4O4P — CID 159814600
1-[(2R,4S,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-fluorooxolan-2-yl]-4,5-dimethylpyrimidin-2-one (PubChem CID 159814600) has the molecular formula C20H32FN4O4P and a molecular weight of 443.48 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-fluorooxolan-2-yl]-4,5-dimethylpyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-fluorooxolan-2-yl]-4,5-dimethylpyrimidin-2-one |
|---|---|
| PubChem CID | 159814600 |
| Molecular Formula | C20H32FN4O4P |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 1-[(2R,4S,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-fluorooxolan-2-yl]-4,5-dimethylpyrimidin-2-one |
| SMILES | [2H]C[C@H]1O[C@@H](n2cc(C)c(C)nc2=O)C(F)[C@H]1OP(OCC[N+]#[C-])N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H32FN4O4P/c1-12(2)25(13(3)4)30(27-10-9-22-8)29-18-16(7)28-19(17(18)21)24-11-14(5)15(6)23-20(24)26/h11-13,16-19H,9-10H2,1-7H3/t16-,17?,18+,19-,30?/m1/s1/i7D |
| InChIKey | WAALBSVSXCOSRL-RLCUETADSA-N |
| XLogP | 3.78 |
| TPSA | 70.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|