C24H42N4O7P2 — CID 58498247
1-[(2R,3R,4R,5R)-5-[(2S)-1-dimethylphosphorylpropan-2-yl]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-methoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 58498247) has the molecular formula C24H42N4O7P2 and a molecular weight of 560.57 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[(2S)-1-dimethylphosphorylpropan-2-yl]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-methoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[(2S)-1-dimethylphosphorylpropan-2-yl]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-methoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58498247 |
| Molecular Formula | C24H42N4O7P2 |
| Molecular Weight | 560.57 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[(2S)-1-dimethylphosphorylpropan-2-yl]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-methoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | [C-]#[N+]CCOP(O[C@H]1[C@@H](OC)[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1[C@H](C)CP(C)(C)=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C24H42N4O7P2/c1-15(2)28(16(3)4)36(33-12-11-25-7)35-20-19(18(6)14-37(9,10)31)34-23(21(20)32-8)27-13-17(5)22(29)26-24(27)30/h13,15-16,18-21,23H,11-12,14H2,1-6,8-10H3,(H,26,29,30)/t18-,19-,20-,21-,23-,36?/m1/s1 |
| InChIKey | VQKODRYIRKJRAG-SOEBKROKSA-N |
| XLogP | 3.68 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|