C22H35N4O5P — CID 159307724
1-[(2R,3aR,7R,7aS)-7-deuterio-3a-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 159307724) has the molecular formula C22H35N4O5P and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-[(2R,3aR,7R,7aS)-7-deuterio-3a-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3aR,7R,7aS)-7-deuterio-3a-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 159307724 |
| Molecular Formula | C22H35N4O5P |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 1-[(2R,3aR,7R,7aS)-7-deuterio-3a-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | [2H][C@@H]1CCC[C@@]2(OP(OCC[N+]#[C-])N(C(C)C)C(C)C)C[C@H](n3cc(C)c(=O)[nH]c3=O)O[C@@H]12 |
| InChI | InChI=1S/C22H35N4O5P/c1-15(2)26(16(3)4)32(29-12-11-23-6)31-22-10-8-7-9-18(22)30-19(13-22)25-14-17(5)20(27)24-21(25)28/h14-16,18-19H,7-13H2,1-5H3,(H,24,27,28)/t18-,19+,22+,32?/m0/s1/i9D/t9-,18+,19-,22-,32?/m1 |
| InChIKey | VANYKSYWUNWRFD-PALPGPMNSA-N |
| XLogP | 3.74 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|